Chiral Reagents
A chiral derivatizing agent (CDA) also known as a chiral resolving reagent, is a chiral auxiliary which can convert a mixture of enantiomers into diastereomers in order to analyse the quantities of each enantiomer present within the mix. In NMR spectroscopy these compounds are called chiral shift reagents.
Since NMR spectroscopy has been available to chemists, there have been numerous studies on the applications of this technique. One of these noted the difference in the chemical shift (i.e. the distance between the peaks) of two diastereomers.[1] Conversely, two compounds that are enantiomers have the same NMR spectral properties. It was reasoned that if a mix of enantiomers could be converted into a mix of diastereomers by bonding them to another chemical that was itself chiral, it would be possible to distinguish this new mixture using NMR, and therefore learn about the original enantiomeric mixture. The first popular example of this technique was published in 1969 by Harry S. Mosher. The chiral agent is a single enantiomer of MTPA (á-methoxy-á-(trifluoromethyl)phenylacetic acid), also known as Moshers acid.[2] The corresponding acid chloride is also known as Moshers acid chloride, and the resultant diastereomeric esters are known as Moshers esters. Another system is Pirkles Alcohol developed in 1977
MTS and Sulfhydryl Active Reagents
Nitric Oxide Reagents
Catalog No. | Product Name | Enrichment |
|
||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
6351 | 1-Amino-11-azido-3,6,9-trioxaundecane |
|
|||||||||||||
6824 |
1-Amino-3,6,9-trioxaundecanyl-11-ol
Synonyms: (PEO)4-mono-amine; |
|
|||||||||||||
6549 | 3-[(2-Aminoethyl)dithio]propionic Acid |
|
|||||||||||||
6553 | N-(2-Aminoethyl)maleimide, Trifluoroacetic Acid |
|
|||||||||||||
6645 | O6-[4-(Aminomethyl)benzyl]guanine |
|
|||||||||||||
6715 |
(S)-1-(4-Aminoxyacetamidobenzyl)ethylenediaminetetraacetic Acid
Synonyms: AABE; |
|
|||||||||||||
7028 | 4-Azido-2,3,5,6-tetrafluorobenzoic Acid |
|
|||||||||||||
7038 | 1-Azido-3,6,9-trioxaundecane-11-ol |
|
|||||||||||||
7013 | 2-[2-(2-Azidoethoxy)ethoxy]ethanol |
|
|||||||||||||
7564 | N-(2-[(t-Boc)amino]ethyl Maleimide |
|
|||||||||||||
7547 |
t-Boc-aminocaproic-N-hydroxysuccinimide
Synonyms: t-Boc-AC-NHS; |
|
|||||||||||||
7561 | 2-[2-(2-t-Boc-aminoethoxy]ethoxy]ethanol |
|
|||||||||||||
7563 |
2-[2-[2-(2-t-Boc-aminoethoxy]ethoxy]ethoxy]-4-[3-(trifluoromethyl )-3H-diazirin-3-yl]benzoic Acid Methyl Ester
Synonyms: 2-[(12,12-dimethyl-10-oxo-3,6,11-trioxa-9-azatridec-1-yl)oxy]-4- [3-(trifluoromethyl)-3H-diazirin-3-yl]Benzoic acid, methyl ester; |
|
|||||||||||||
7562 | 2-[2-(2-t-Boc-aminoethoxy]ethoxy]ethyl Bromide |
|
|||||||||||||
7071 | t-Boc-aminooxyacetic Acid |
|
|||||||||||||
7568 | 4-(N-Boc-aminoxyacetamido)benzyl Ethylenediaminetetraacetic Acid, Tetra(t-butyl) Ester |
|
|||||||||||||
8095 | N-(10-Carboxydecanyl)maleamideic Acid |
|
|||||||||||||
7464 | (+/-)-trans-1,2-Bis(chloroacetamido)cyclohexane |
|
|||||||||||||
8773 |
1,10-Decadiyl Bismethanethiosulfonate
Synonyms: MTS-10-MTS; |
|
|||||||||||||
9154 | 1,11-Diazido-3,6,9-trioxaundecane |
|
|||||||||||||
9235 | 1,14-Dibromo-3,6,9,12-tetraoxatetradecane |
|
|||||||||||||
9214 |
Dibromobimane
Synonyms: DBBR; |
|
|||||||||||||
9248 | N,N-Dicarboxymethyl-N,N-dinitroso-p-phenylenediamine Disodium Salt |
|
|||||||||||||
9450 | N-Dihydrocinnamoylaminocaproic Acid, N-Hydroxysuccinimide Ester |
|
|||||||||||||
9637 | N,N-Dimethyl-N,N-dinitroso-p-phenylenediamine |
|
|||||||||||||
9720 | N,N-Dinitroso-p-phenylenediamine-N,N-diacetic Acid |
|
|||||||||||||
9730 |
3,6-Dioxaoctane-1,8-diyl Bismethanethiosulfonate
Synonyms: Mts-8-O2-Mts; |
|
|||||||||||||
9772 |
Disuccinimidyl L-Tartrate
Synonyms: DST; |
|
|||||||||||||
9776 |
N-(Dithiocarbamoyl)-N-Methyl-D-Glucamine, Sodium Salt
Synonyms: MGD; |
|
|||||||||||||
9777 |
N-(Dithiocarboxy)sarcosine, Diammonium Salt
Synonyms: DTCS; |
|
|||||||||||||
9914 |
1,2-Ethanediyl Bismethanethiosulfonate
Synonyms: MTS-2-MTS; |
|
|||||||||||||
10143 | S-Ethyl N-Phenylisothiourea |
|
|||||||||||||
10170 |
S-Ethyl N-[4-Triflurormethyl)phenyl]isothiourea HCl
Synonyms: ETPI HCl; |
|
|||||||||||||
10078 |
N-Ethyl-2-(1-Ethyl-2-Hydroxy-2-Nitrosohydrazino) Ethanamine
Synonyms: NOC 12; |
|
|||||||||||||
10445 |
Fructose-1-S-nitroso-N-acetyl-DL-penicillamine
Synonyms: Fructose-1-SNAP; |
|
|||||||||||||
10568 | S-(2-Glycylamidoethyl)dithio-2-pyridine |
|
|||||||||||||
10634 |
1,6-Hexanediyl Bismethanethiosulfonate
Synonyms: MTS-6-MTS; |
|
|||||||||||||
10813 | Hydroxyguanidine Sulfate |
|
|||||||||||||
10934 |
N-omega-Hydroxyl-nor-L-Arginine DiHCl
Synonyms: nor-NOHA; |
|
|||||||||||||
11031 |
N-Hydroxysuccinimidyl-trans-4-isopropylcyclohexanecarboxylate
Synonyms: 4-trans-Isopropylcyclohexanecarboxylic Acid, N-Succunimidyl Ester; |
|
|||||||||||||
11032 | N-Hydroxysulfosuccinimide, Sodium Salt |
|
|||||||||||||
11245 |
Isosorbide dinitrate
Synonyms: 1,4:3,6-Dianhydro-D-glucitol Dinitrate; Dinitrosorbide; 1,4:3,6-Dianhydrosorbitol 2,5-Dinitrate, Carvasin; Cedocard; Corovliss; Dignonitrat; Dilatrate; Diniket, ISDN; |
|
|||||||||||||
11247 |
Isosorbide-2-nitrate
Synonyms: 6-Nitrooxy-hexahydro-furo[3,2-β]furan-3-ol; |
|
|||||||||||||
7499 | (1,8-Bis-maleamic Acid)triethyleneglycol |
|
|||||||||||||
11447 | 6-Maleimido-1-hexanal |
|
|||||||||||||
11434 | Maleimidoacetic Acid N-Hydroxysuccinimide Ester |
|
|||||||||||||
11436 |
3-N-Maleimidobenzoic Acid N-Succinimidyl Ester
Synonyms: MBS; |
|
|||||||||||||
11439 | 4-Maleimidobutyric Acid |
|
|||||||||||||
11444 | N-(2-Maleimidoethyl)-6-aminohexanamide, Trifluoroacetic Acid Salt |
|
|||||||||||||
11445 | N-(2-Maleimidoethyl)-6-t-Boc-aminohexanamide |
|
|||||||||||||
11446 | [N-(2-Maleimidoethyl]diethylenetriaminepentaacetic Acid, Monoamide |
|
|||||||||||||
11572 |
1,1-Methanediyl Bismethanethiosulfonate
Synonyms: MTS-1-MTS; |
|
|||||||||||||
11577 | 1-Methanesulfonyl-11-hydroxy-3,6,9-trioxaundecane |
|
|||||||||||||
7509 | 1,11-Bis(methanesulfonyloxy)-3,6,9-trioxandecane |
|
|||||||||||||
7510 | Bis-(2-methanethiosulfonatoethyl)dimethylammonium Chloride |
|
|||||||||||||
11587 |
16-Methanethiosulfonyl Hexadecanoic Acid
Synonyms: MTS-16-HDA; |
|
|||||||||||||
11622 | N-(Methoxycarbonyl) Maleimide |
|
|||||||||||||
12216 | Methyl N-Succinimidyl Adipate |
|
|||||||||||||
11980 | 4-Methyl-1-hydrazinophthalizine, HCl |
|
|||||||||||||
12244 | S-Methyl-L-thiocitrulline dihydrochloride |
|
|||||||||||||
10873 |
3-[2-Hydroxy-1-(1-Methylethyl)-2-Nitrosohydrazino]-1-Propanamine
Synonyms: NOC 5; |
|
|||||||||||||
12658 | N-Nitroso Akardite II |
|
|||||||||||||
12670 |
S-Nitroso-L-glutathione
Synonyms: GNSO; |
|
|||||||||||||
12657 |
S-Nitroso-N-acetyl-DL-penicillamine
Synonyms: SNAP; |
|
|||||||||||||
12672 |
S-Nitroso-N-heptanoyl-DL-penicillamine
Synonyms: SNHP; |
|
|||||||||||||
12684 |
S-Nitroso-N-propionyl-DL-penicillamine
Synonyms: SNPP; |
|
|||||||||||||
12691 |
S-Nitroso-N-valeryl-D,L-penicillamine
Synonyms: SNVP; |
|
|||||||||||||
12686 | 1-Nitrosopyrrolidine |
|
|||||||||||||
12777 |
Olaquindox
Synonyms: N-(2-Hydroxyethyl)-3-methyl-2-quinoxalinecarboxamide 1,4-Dioxide; Bayernox; BayoNox; Bisergon; Fedan; NSC 634933; |
|
|||||||||||||
12932 |
1,5-Pentanediyl Bismethanethiosulfonate
Synonyms: MTS-5-MTS; |
|
|||||||||||||
12933 | 3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl Bis-amine |
|
|||||||||||||
12934 | 3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl Bis-azide |
|
|||||||||||||
12935 | 3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl Bis-bromide |
|
|||||||||||||
12936 |
3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl Bis- methanethiosulfonate
Synonyms: MTS-17-O5-MTS; |
|
|||||||||||||
13037 |
4-Phenyl-3-furoxancarbonitrile
Synonyms: Furoxan, RVC-589; |
|
|||||||||||||
13176 |
1,3-Propanediyl Bismethanethiosulfonate
Synonyms: MTS-3-MTS; |
|
|||||||||||||
13274 |
3-(2-Pyridyldithio)propanoic Acid
Synonyms: 2-Carboxyethyl 2-Pyridyl Disulfide; 3-(2-Pyridinyldithio)propanoic Acid; |
|
|||||||||||||
13275 |
3-(2-Pyridyldithio)propanoic Acid Hydrazide
Synonyms: PDTPA-Hydrazide; |
|
|||||||||||||
13291 |
3-(2-Pyridyldithio)propionic Acid N-Succinimidyl Ester
Synonyms: SPDP; 3-(Pyridin-2-yldisulfanyl)-propionic acid-Osu; |
|
|||||||||||||
13289 |
(S)-2-Pyridylthio Cysteamine HCl
Synonyms: S-(2-Aminoethyl)dithio-2-pyridine Hydrochloride, S-(2-Pyridylthio )cysteamine Hydrochloride; |
|
|||||||||||||
13290 |
N-[S-(2-Pyridylthioethyl)-t-Boc-aminooxyacetamide
Synonyms: Boc-Aoa-NH-(CH2)2-S-S-Pyr; |
|
|||||||||||||
13512 | Spermine Bis (Nitric Oxide) Adduct |
|